Pyronine B

Research use only, not for human use.

Pyronine B (NSC 44690) is a fluorophore with low relative fluorophore brightness and a small hydrophobic (SH) protein channel inhibitor, which is used for staining of bacteria and mycobacteria and in the spectrophotometric determination of ultra-trace ruthenium.

Pyronin B is an organic cationic dye used for the staining of bacteria, mycobacteria and ribonucleic acids. Pyronin B is also used as a small hydrophobic (SH) protein channel inhibitor.

Pyronin B (0-15 μM) inhibits channel activity of approximately 60% of small hydrophobic (SH) proteins at a concentration of 10 μM, and the Kd value of 6.8 μM.Pyronin B (0-0.25 μM) affects RSV replication in Vero cells in a dose-dependent manner, and its TCID50 (50% tissue culture infection dose) = 0 at the concentration of 0.25 μM.Pyronin B (10 μM) can react with bromate in an oxidation reaction and the reaction rate increases dramatically with the addition of trace amounts of Ti (IV) with the characteristic absorption spectra of 555 nm.

——

——

Autophagy

Autophagy

Autophagy

——

——

2150-48-3

358.91

C21H27ClN2O

>98% (HPLC)

In Vitro:?DMSO : 20.83 mg/mL (58.04 mM; Ultrasonic (<60°C)

[Cl-].[O+]=1C=2C=C(C=CC2C=C3C=CC(=CC13)N(CC)CC)N(CC)CC

——

(-20℃)

With Ice Pack

≥ 2 years