C-82

Research use only, not for human use.

C-82 is a specific CBP/β-catenin antagonist. It inhibits the binding between β-catenin and CBP and increases the binding between β-catenin and p300.

C-82 is a specific CBP/β-catenin antagonist. It inhibits the binding between β-catenin and CBP and increases the binding between β-catenin and p300.(In Vitro):C-82 inhibits the activation of isolated primary mouse quiescent hepatic stellate cells (HSCs) and promotes cell death in culture-activated HSCs.(In Vivo):PRI-724 is phosphorylated-C-82 and is rapidly hydrolyzed to its active form C-82 in vivo, and pre-clinical studies have shown a very acceptable toxicity profile.

——

——

——

Chromatin/Epigenetic

Epigenetic Reader Domain

——

——

——

1422253-37-9

578.673

C33H34N6O4

>98% (HPLC)

——

[H][C@]12[C@H](C)N(Cc3cccc4cccnc34)C(=O)[C@H](Cc3ccc(O)cc3)N1C(=O)CN(C)N2C(=O)NCc1ccccc1

——

(-20℃)

With Ice Pack

≥ 2 years