Carazolol-d7

Research use only, not for human use.

Carazolol-d7 is the deuterium labeled Carazolol.Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process.

Carazolol-d7 is the deuterium labeled Carazolol.Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs.Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs.

Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs.

——

(±)-Carazolol-d7; DL-Carazolol-d7; Suacron-d7

Neuroscience

Other Targets

——

——

——

1173021-02-7

305.42

C18H15D7N2O2

>98% (HPLC)

——

[2H]C([2H])([2H])C(C([2H])([2H])[2H])([2H])NCC(O)COC1=C2C3=CC=CC=C3NC2=CC=C1

——

(-20℃)

With Ice Pack

≥ 2 years